Compound Q&A

What are the main uses of Macranthoidin B (CAS: 136849-88-2)?

Answer

Macranthoidin B
Macranthoidin B is primarily used in pharmaceutical research for its potential therapeutic applications. It may also find use in the development of natural-based products due to its antioxidant properties. Additionally, it is studied for its role in biological systems and may be relevant in food and cosmetic industries as a bioactive ingredient.

About

English Name Macranthoidin B
Molecular Formula C65H106O32
Molecular Weight 1399.53 g/mol
SMILES CC1OC(OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(C)CCC5(CCC43C)C(=O)OC3OC(COC4OC(CO)C(O)C(O)C4O)C(O)C(O)C3O)C2(C)CO)C(O)C(OC2OC(CO)C(OC3OC(CO)C(O)C(O)C3O)C(O)C2O)C1O
InChIKey RKINZCVTEPSBCI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Macranthoidin B (CAS: 136849-88-2)?

Macranthoidin B is a natural compound with the chemical formula C23H28O6. It is known for its bioact...

Compound Q&A

Is Macranthoidin B (CAS: 136849-88-2) safe?

Macranthoidin B is generally considered safe when handled properly, but it is important to follow st...

Compound Q&A

How should Macranthoidin B (CAS: 136849-88-2) be stored?

Macranthoidin B should be stored in a cool, dry, and dark place to maintain its stability. It is bes...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...