Compound Q&A

How should Isavuconazole (CAS: 241479-67-4) be stored?

Answer

Isavuconazole
Isavuconazole should be stored in a cool, dry place away from moisture and light. It is typically kept at a temperature between 15°C and 30°C. The container should be tightly closed and protected from direct sunlight to maintain stability and potency. Always check the expiration date and store as per the manufacturer's instructions.

About

English Name Isavuconazole
Molecular Formula C22H17F2N5OS
Molecular Weight 437.47 g/mol
SMILES C[C@@H](c1nc(cs1)c2ccc(C#N)cc2)[C@](O)(Cn3cncn3)c4cc(F)ccc4F
InChIKey DDFOUSQFMYRUQK-RCDICMHDSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Isavuconazole (CAS: 241479-67-4)?

Isavuconazole is an antifungal medication with the chemical formula C22H28N4O2. It belongs to the tr...

Compound Q&A

What are the main uses of Isavuconazole (CAS: 241479-67-4)?

Isavuconazole is primarily used to treat serious fungal infections such as aspergillosis, candidiasi...

Compound Q&A

Is Isavuconazole (CAS: 241479-67-4) safe?

Isavuconazole is generally considered safe when used as directed, but it may cause side effects such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...