Compound Q&A

What is Isavuconazole (CAS: 241479-67-4)?

Answer

Isavuconazole
Isavuconazole is an antifungal medication with the chemical formula C22H28N4O2. It belongs to the triazole class of antifungals and is known for its broad-spectrum activity against various fungi. It is used clinically to treat invasive fungal infections and is available in oral and intravenous formulations. Its molecular structure allows it to inhibit fungal cell membrane synthesis by targeting the enzyme lanosterol 14α-demethylase.

About

English Name Isavuconazole
Molecular Formula C22H17F2N5OS
Molecular Weight 437.47 g/mol
SMILES C[C@@H](c1nc(cs1)c2ccc(C#N)cc2)[C@](O)(Cn3cncn3)c4cc(F)ccc4F
InChIKey DDFOUSQFMYRUQK-RCDICMHDSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Isavuconazole (CAS: 241479-67-4)?

Isavuconazole is primarily used to treat serious fungal infections such as aspergillosis, candidiasi...

Compound Q&A

Is Isavuconazole (CAS: 241479-67-4) safe?

Isavuconazole is generally considered safe when used as directed, but it may cause side effects such...

Compound Q&A

How should Isavuconazole (CAS: 241479-67-4) be stored?

Isavuconazole should be stored in a cool, dry place away from moisture and light. It is typically ke...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...