Compound Q&A

How should 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) be stored?

Answer

2,6-Dichloro-4-nitroaniline
2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) should be stored in a cool, dry, and well-ventilated area, away from direct light. It is best kept in a sealed container to prevent moisture absorption. Maintaining stable storage conditions is essential to preserve its chemical integrity and ensure safety during handling.

About

CAS No 99-30-9
English Name 2,6-Dichloro-4-nitroaniline
Molecular Formula C6H4Cl2N2O2
Molecular Weight 207.01 g/mol
SMILES Nc1c(Cl)cc(cc1Cl)[N+](=O)[O-]
InChIKey BIXZHMJUSMUDOQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9)?

2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) is an aromatic organic compound with the chemical formula...

Compound Q&A

What are the main uses of 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9)?

2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) is primarily used in the synthesis of pharmaceuticals, dy...

Compound Q&A

Is 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) safe?

2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) requires careful handling due to potential toxicity. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...