Compound Q&A

What is 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9)?

Answer

2,6-Dichloro-4-nitroaniline
2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) is an aromatic organic compound with the chemical formula C6H6Cl2N2O2. It is a white crystalline solid that is typically used in chemical synthesis due to its reactivity and functional groups. The compound contains two chlorine atoms and one nitro group attached to aniline structure, making it useful in various chemical processes.

About

CAS No 99-30-9
English Name 2,6-Dichloro-4-nitroaniline
Molecular Formula C6H4Cl2N2O2
Molecular Weight 207.01 g/mol
SMILES Nc1c(Cl)cc(cc1Cl)[N+](=O)[O-]
InChIKey BIXZHMJUSMUDOQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9)?

2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) is primarily used in the synthesis of pharmaceuticals, dy...

Compound Q&A

Is 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) safe?

2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) requires careful handling due to potential toxicity. It i...

Compound Q&A

How should 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) be stored?

2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) should be stored in a cool, dry, and well-ventilated area...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...