Compound Q&A

Is 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) safe?

Answer

2,6-Dichloro-4-nitroaniline
2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) requires careful handling due to potential toxicity. It is considered harmful to health and the environment, so protective measures such as gloves, goggles, and proper ventilation should be used. Safety standards emphasize the need for controlled exposure and adherence to chemical safety guidelines.

About

CAS No 99-30-9
English Name 2,6-Dichloro-4-nitroaniline
Molecular Formula C6H4Cl2N2O2
Molecular Weight 207.01 g/mol
SMILES Nc1c(Cl)cc(cc1Cl)[N+](=O)[O-]
InChIKey BIXZHMJUSMUDOQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9)?

2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) is an aromatic organic compound with the chemical formula...

Compound Q&A

What are the main uses of 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9)?

2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) is primarily used in the synthesis of pharmaceuticals, dy...

Compound Q&A

How should 2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) be stored?

2,6-Dichloro-4-nitroaniline (CAS: 99-30-9) should be stored in a cool, dry, and well-ventilated area...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...