Compound Q&A

How should (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4) be stored?

Answer

(2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid
This compound should be stored in a cool, dry, and dark place, preferably at 2-8°C, in a sealed container to prevent moisture ingress. It is recommended to keep it away from strong light and incompatible substances to maintain its stability and prevent degradation. Storage should follow guidelines for chemical safety and proper labeling is essential.

About

English Name (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid
Molecular Formula C17H27NO5
Molecular Weight 325.41 g/mol
SMILES CC(C)(C)OC(=O)NC(C(=O)O)C12CC3CC(C1)CC(C3)(C2)O
InChIKey UKCKDSNFBFHSHC-ZEJPWUNMSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4)?

This compound, with the CAS number 361442-00-4, is a complex organic molecule characterized by its a...

Compound Q&A

What are the main uses of (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4)?

The compound is primarily used in pharmaceutical research as a building block for the synthesis of v...

Compound Q&A

Is (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4) safe?

Safety data for this compound is limited, but it is generally considered safe when handled properly....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...