Compound Q&A

What are the main uses of (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4)?

Answer

(2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid
The compound is primarily used in pharmaceutical research as a building block for the synthesis of various drugs and bioactive molecules. It may also find applications in organic chemistry for creating complex structures, and in biochemical studies due to its unique functional groups. Its potential utility in drug delivery systems and as a chiral intermediate is of interest in the chemical and medicinal industries.

About

English Name (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid
Molecular Formula C17H27NO5
Molecular Weight 325.41 g/mol
SMILES CC(C)(C)OC(=O)NC(C(=O)O)C12CC3CC(C1)CC(C3)(C2)O
InChIKey UKCKDSNFBFHSHC-ZEJPWUNMSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4)?

This compound, with the CAS number 361442-00-4, is a complex organic molecule characterized by its a...

Compound Q&A

Is (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4) safe?

Safety data for this compound is limited, but it is generally considered safe when handled properly....

Compound Q&A

How should (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4) be stored?

This compound should be stored in a cool, dry, and dark place, preferably at 2-8°C, in a sealed cont...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...