Compound Q&A

What is (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4)?

Answer

(2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid
This compound, with the CAS number 361442-00-4, is a complex organic molecule characterized by its adamantan-1-yl group, hydroxyl functionality, and amino acetic acid moiety. It is a white to off-white solid with high molecular weight and exhibits moderate solubility in polar solvents. The compound is known for its structural complexity, which makes it a potential candidate for pharmaceutical applications, particularly in drug development and biochemistry research.

About

English Name (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid
Molecular Formula C17H27NO5
Molecular Weight 325.41 g/mol
SMILES CC(C)(C)OC(=O)NC(C(=O)O)C12CC3CC(C1)CC(C3)(C2)O
InChIKey UKCKDSNFBFHSHC-ZEJPWUNMSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4)?

The compound is primarily used in pharmaceutical research as a building block for the synthesis of v...

Compound Q&A

Is (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4) safe?

Safety data for this compound is limited, but it is generally considered safe when handled properly....

Compound Q&A

How should (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid (CAS: 361442-00-4) be stored?

This compound should be stored in a cool, dry, and dark place, preferably at 2-8°C, in a sealed cont...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...