Compound Q&A

How should 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) be stored?

Answer

2-Chloro-5-nitrobenzoic acid
2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) should be stored in a cool, dry, and well-ventilated place, away from direct sunlight. It is best kept in a sealed container to prevent moisture absorption. Storage conditions should maintain a temperature below 25°C and avoid exposure to humidity or incompatible materials to ensure stability and safety.

About

CAS No 2516-96-3
English Name 2-Chloro-5-nitrobenzoic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Cl
InChIKey QUEKGYQTRJVEQC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3)?

2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) is an aromatic compound that contains a benzene ring w...

Compound Q&A

What are the main uses of 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3)?

2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) is primarily used in pharmaceutical research as a buil...

Compound Q&A

Is 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) safe?

2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) is considered hazardous due to its potential to cause ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...