Compound Q&A

What are the main uses of 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3)?

Answer

2-Chloro-5-nitrobenzoic acid
2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) is primarily used in pharmaceutical research as a building block for drug development. It also finds applications in the synthesis of dyes, agrochemicals, and organic intermediates. Its unique structure makes it valuable in industrial processes and chemical research for creating derivatives with specific functionalities.

About

CAS No 2516-96-3
English Name 2-Chloro-5-nitrobenzoic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Cl
InChIKey QUEKGYQTRJVEQC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3)?

2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) is an aromatic compound that contains a benzene ring w...

Compound Q&A

Is 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) safe?

2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) is considered hazardous due to its potential to cause ...

Compound Q&A

How should 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) be stored?

2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) should be stored in a cool, dry, and well-ventilated p...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...