Compound Q&A

What is 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3)?

Answer

2-Chloro-5-nitrobenzoic acid
2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) is an aromatic compound that contains a benzene ring with a carboxylic acid group, a chlorine atom, and a nitro group. It is commonly used in chemical synthesis due to its versatile functional groups. The compound has a molecular formula of C7H5ClN2O3 and is known for its acidic properties and potential reactivity in organic reactions.

About

CAS No 2516-96-3
English Name 2-Chloro-5-nitrobenzoic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Cl
InChIKey QUEKGYQTRJVEQC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3)?

2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) is primarily used in pharmaceutical research as a buil...

Compound Q&A

Is 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) safe?

2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) is considered hazardous due to its potential to cause ...

Compound Q&A

How should 2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) be stored?

2-Chloro-5-nitrobenzoic acid (CAS: 2516-96-3) should be stored in a cool, dry, and well-ventilated p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...