Compound Q&A

How should 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) be stored?

Answer

3-[3-(Trifluoromethyl)phenyl]propanoic acid
3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) should be stored in a cool, dry, and well-ventilated area, away from light. It is best kept in a sealed container to prevent moisture absorption and maintain chemical stability. Storage at temperatures below 25°C is recommended, and it should be protected from potential contaminants to ensure its integrity and effectiveness over time.

About

CAS No 585-50-2
English Name 3-[3-(Trifluoromethyl)phenyl]propanoic acid
Molecular Formula C10H9F3O2
Molecular Weight 218.17 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)CCC(=O)O
InChIKey YLTJJMIWCCJIHI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2)?

3-[3-(Trifluoromethyl)phenyl]propanoic acid, with the CAS number 585-50-2, is an organic compound co...

Compound Q&A

What are the main uses of 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2)?

3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) is primarily used in pharmaceutical rese...

Compound Q&A

Is 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) safe?

3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) is generally considered safe when handle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...