Compound Q&A

What is 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2)?

Answer

3-[3-(Trifluoromethyl)phenyl]propanoic acid
3-[3-(Trifluoromethyl)phenyl]propanoic acid, with the CAS number 585-50-2, is an organic compound containing a trifluoromethyl group attached to a phenyl ring, which is further linked to a propanoic acid chain. It is a white crystalline solid with a carboxylic acid functional group, making it acidic in nature. This compound is known for its stability and is commonly used in various chemical applications due to its unique molecular structure and reactivity.

About

CAS No 585-50-2
English Name 3-[3-(Trifluoromethyl)phenyl]propanoic acid
Molecular Formula C10H9F3O2
Molecular Weight 218.17 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)CCC(=O)O
InChIKey YLTJJMIWCCJIHI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2)?

3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) is primarily used in pharmaceutical rese...

Compound Q&A

Is 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) safe?

3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) is generally considered safe when handle...

Compound Q&A

How should 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) be stored?

3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) should be stored in a cool, dry, and wel...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...