Compound Q&A

What are the main uses of 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2)?

Answer

3-[3-(Trifluoromethyl)phenyl]propanoic acid
3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) is primarily used in pharmaceutical research as a building block for drug development. It is also employed in the synthesis of agrochemicals and organic materials. Its applications span across chemical industries for creating derivatives with specific functional properties. Additionally, it is used in research settings to study the effects of trifluoromethyl substitution on molecular behavior and reactivity.

About

CAS No 585-50-2
English Name 3-[3-(Trifluoromethyl)phenyl]propanoic acid
Molecular Formula C10H9F3O2
Molecular Weight 218.17 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)CCC(=O)O
InChIKey YLTJJMIWCCJIHI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2)?

3-[3-(Trifluoromethyl)phenyl]propanoic acid, with the CAS number 585-50-2, is an organic compound co...

Compound Q&A

Is 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) safe?

3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) is generally considered safe when handle...

Compound Q&A

How should 3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) be stored?

3-[3-(Trifluoromethyl)phenyl]propanoic acid (CAS: 585-50-2) should be stored in a cool, dry, and wel...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...