Compound Q&A

How should Copper(2+) di(D-gluconate) (CAS: 527-09-3) be stored?

Answer

Copper(2+) di(D-gluconate)
Copper(2+) di(D-gluconate) (CAS: 527-09-3) should be stored in a cool, dry place at temperatures below 25°C, away from light and moisture. Keep it in airtight containers to maintain stability and prevent degradation. Avoid exposure to incompatible substances such as strong acids or bases. Ensure proper ventilation in storage areas to minimize inhalation risks. Always store in a secure location to maintain safety and efficacy.

About

CAS No 527-09-3
English Name Copper(2+) di(D-gluconate)
Molecular Formula C12H22CuO14
Molecular Weight 453.84 g/mol
SMILES C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Cu+2]
InChIKey OCUCCJIRFHNWBP-IYEMJOQQSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Copper(2+) di(D-gluconate) (CAS: 527-09-3)?

Copper(2+) di(D-gluconate) (CAS: 527-09-3) is a copper salt formed by the reaction of copper(II) ion...

Compound Q&A

What are the main uses of Copper(2+) di(D-gluconate) (CAS: 527-09-3)?

Copper(2+) di(D-gluconate) (CAS: 527-09-3) is primarily used in pharmaceuticals as a dietary supplem...

Compound Q&A

Is Copper(2+) di(D-gluconate) (CAS: 527-09-3) safe?

Copper(2+) di(D-gluconate) (CAS: 527-09-3) is generally considered safe when used in recommended con...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...