Compound Q&A

What is Copper(2+) di(D-gluconate) (CAS: 527-09-3)?

Answer

Copper(2+) di(D-gluconate)
Copper(2+) di(D-gluconate) (CAS: 527-09-3) is a copper salt formed by the reaction of copper(II) ions with D-gluconic acid. Its chemical formula is Cu(C6H11O7)2. This compound is known for its blue crystalline appearance, high water solubility, and chelating properties, making it useful in various industrial and pharmaceutical applications. It acts as a stabilizer and antioxidant due to its ability to bind with metal ions and prevent oxidation reactions.

About

CAS No 527-09-3
English Name Copper(2+) di(D-gluconate)
Molecular Formula C12H22CuO14
Molecular Weight 453.84 g/mol
SMILES C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Cu+2]
InChIKey OCUCCJIRFHNWBP-IYEMJOQQSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Copper(2+) di(D-gluconate) (CAS: 527-09-3)?

Copper(2+) di(D-gluconate) (CAS: 527-09-3) is primarily used in pharmaceuticals as a dietary supplem...

Compound Q&A

Is Copper(2+) di(D-gluconate) (CAS: 527-09-3) safe?

Copper(2+) di(D-gluconate) (CAS: 527-09-3) is generally considered safe when used in recommended con...

Compound Q&A

How should Copper(2+) di(D-gluconate) (CAS: 527-09-3) be stored?

Copper(2+) di(D-gluconate) (CAS: 527-09-3) should be stored in a cool, dry place at temperatures bel...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...