Compound Q&A

How should 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) be stored?

Answer

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid
1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) should be stored in a cool, dry, and well-ventilated area, away from light. It is recommended to keep it in a sealed container to prevent moisture absorption and contamination. Storage at temperatures below 25°C is ideal to maintain stability and prolong shelf life.

About

English Name 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid
Molecular Formula C11H10FNO3
Molecular Weight 223.2 g/mol
SMILES OC(=O)C1(CC1)C(=O)Nc2ccc(F)cc2
InChIKey PFMAFXYUHZDKPY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7)?

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) is a chemical compound c...

Compound Q&A

What are the main uses of 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7)?

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) is primarily used in pha...

Compound Q&A

Is 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) safe?

The safety of 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) depends on...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...