Compound Q&A

What are the main uses of 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7)?

Answer

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid
1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) is primarily used in pharmaceutical research as a building block for drug development. It may also find applications in organic synthesis, biochemical studies, and as an intermediate in the production of various chemical compounds. Its unique structure makes it valuable for studying molecular interactions and biological activity.

About

English Name 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid
Molecular Formula C11H10FNO3
Molecular Weight 223.2 g/mol
SMILES OC(=O)C1(CC1)C(=O)Nc2ccc(F)cc2
InChIKey PFMAFXYUHZDKPY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7)?

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) is a chemical compound c...

Compound Q&A

Is 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) safe?

The safety of 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) depends on...

Compound Q&A

How should 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) be stored?

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) should be stored in a co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...