Compound Q&A

Is 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) safe?

Answer

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid
The safety of 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) depends on its handling and exposure conditions. As a chemical compound, it may require standard laboratory safety precautions, including use of personal protective equipment (PPE) and proper ventilation. It is advisable to follow safety guidelines provided by manufacturers and regulatory bodies to ensure safe use in research and industrial settings.

About

English Name 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid
Molecular Formula C11H10FNO3
Molecular Weight 223.2 g/mol
SMILES OC(=O)C1(CC1)C(=O)Nc2ccc(F)cc2
InChIKey PFMAFXYUHZDKPY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7)?

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) is a chemical compound c...

Compound Q&A

What are the main uses of 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7)?

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) is primarily used in pha...

Compound Q&A

How should 1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) be stored?

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid (CAS: 849217-48-7) should be stored in a co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...