Compound Q&A

What are the main uses of (4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 84793-07-7)?

Answer

(4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid
This compound is primarily used in pharmaceutical research as a protected amino acid derivative, enabling controlled functionalization in drug molecule synthesis. It serves as an intermediate in the development of bioactive compounds and is also employed in organic chemistry for structural studies. Its unique Fmoc group and tert-butyl protection make it valuable in peptide chemistry and advanced chemical applications.

About

CAS No 84793-07-7
English Name (4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid
Molecular Formula C24H27NO6
Molecular Weight 425.48 g/mol
SMILES CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OCC1c2ccccc2-c3ccccc13
InChIKey GOPWHXPXSPIIQZ-FQEVSTJZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 84793-07-7)?

This compound is a complex organic molecule with the CAS number 84793-07-7. It features a pentanoic ...

Compound Q&A

Is (4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 84793-07-7) safe?

Safety data for this compound is limited, but as a chemical reagent, it requires standard laboratory...

Compound Q&A

How should (4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 84793-07-7) be stored?

Store this compound in a cool, dry place (ideally below 25°C), away from light, and in airtight cont...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...