Compound Q&A

What is (4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 84793-07-7)?

Answer

(4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid
This compound is a complex organic molecule with the CAS number 84793-07-7. It features a pentanoic acid backbone with a 5-oxo group, an amino group protected by a fluoren-9-ylmethoxy carbonyl (Fmoc) moiety, and a tert-butyl ether substituent. Its stereochemistry is defined by the (4S) configuration, making it a key intermediate in pharmaceutical synthesis and molecular research. The structure combines aromatic, aliphatic, and functional groups, contributing to its reactivity and utility in chemical processes.

About

CAS No 84793-07-7
English Name (4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid
Molecular Formula C24H27NO6
Molecular Weight 425.48 g/mol
SMILES CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OCC1c2ccccc2-c3ccccc13
InChIKey GOPWHXPXSPIIQZ-FQEVSTJZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 84793-07-7)?

This compound is primarily used in pharmaceutical research as a protected amino acid derivative, ena...

Compound Q&A

Is (4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 84793-07-7) safe?

Safety data for this compound is limited, but as a chemical reagent, it requires standard laboratory...

Compound Q&A

How should (4S)-4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 84793-07-7) be stored?

Store this compound in a cool, dry place (ideally below 25°C), away from light, and in airtight cont...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...