Compound Q&A

What are the main uses of (2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol (CAS: 14047-28-0)?

Answer

(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol
The compound is primarily utilized in pharmaceutical applications, such as the development of antiviral and antitumor drugs, due to its structural similarity to nucleosides. It serves as a key intermediate in research related to nucleic acid metabolism and is also employed in the synthesis of other bioactive compounds. Its versatility makes it valuable in medicinal chemistry and biochemical studies.

About

CAS No 14047-28-0
English Name (2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol
Molecular Formula C8H11N5O
Molecular Weight 193.21 g/mol
SMILES CC(CN1C=NC2=C(N=CN=C21)N)O
InChIKey MJZYTEBKXLVLMY-RXMQYKEDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol (CAS: 14047-28-0)?

This compound, with the CAS number 14047-28-0, is a nucleoside analog characterized by its chemical ...

Compound Q&A

Is (2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol (CAS: 14047-28-0) safe?

Safety data for this compound indicates it is generally low in toxicity when handled properly. Howev...

Compound Q&A

How should (2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol (CAS: 14047-28-0) be stored?

This compound should be stored in a cool, dry place, away from light, in a sealed container to maint...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...