Compound Q&A

What is (2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol (CAS: 14047-28-0)?

Answer

(2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol
This compound, with the CAS number 14047-28-0, is a nucleoside analog characterized by its chemical structure featuring a purine ring substituted with an amino group at position 6, connected to a 2-propanol moiety. It is a white solid with high water solubility and is commonly used in pharmaceutical research for its potential biological activity. Its molecular formula is C8H12N5O, and it exhibits specific stereochemistry due to the (2R) configuration.

About

CAS No 14047-28-0
English Name (2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol
Molecular Formula C8H11N5O
Molecular Weight 193.21 g/mol
SMILES CC(CN1C=NC2=C(N=CN=C21)N)O
InChIKey MJZYTEBKXLVLMY-RXMQYKEDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol (CAS: 14047-28-0)?

The compound is primarily utilized in pharmaceutical applications, such as the development of antivi...

Compound Q&A

Is (2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol (CAS: 14047-28-0) safe?

Safety data for this compound indicates it is generally low in toxicity when handled properly. Howev...

Compound Q&A

How should (2R)-1-(6-Amino-9H-purin-9-yl)-2-propanol (CAS: 14047-28-0) be stored?

This compound should be stored in a cool, dry place, away from light, in a sealed container to maint...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...