Compound Q&A

How should 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) be stored?

Answer

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate
2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) should be stored in a cool, dry, and dark place at temperatures below 25°C. Keep it in a sealed container to prevent moisture absorption and contamination. Avoid exposure to light and air to maintain stability, and ensure storage in a well-ventilated area to minimize risks associated with its chemical properties.

About

CAS No 65141-46-0
English Name 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate
Molecular Formula C8H9N3O4
Molecular Weight 211.17 g/mol
SMILES C1=CC(=CN=C1)C(=O)NCCO[N+](=O)[O-]
InChIKey LBHIOVVIQHSOQN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0)?

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) is a nitrogen-containing organic compo...

Compound Q&A

What are the main uses of 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0)?

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) is primarily used in pharmaceutical re...

Compound Q&A

Is 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) safe?

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) requires careful handling due to its p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...