Compound Q&A

What are the main uses of 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0)?

Answer

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate
2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) is primarily used in pharmaceutical research as a building block for drug development, particularly in synthesizing anti-inflammatory and antimicrobial agents. It also serves as an industrial chemical intermediate and is relevant in organic chemistry studies for exploring nitrate ester reactivity and functional group modifications.

About

CAS No 65141-46-0
English Name 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate
Molecular Formula C8H9N3O4
Molecular Weight 211.17 g/mol
SMILES C1=CC(=CN=C1)C(=O)NCCO[N+](=O)[O-]
InChIKey LBHIOVVIQHSOQN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0)?

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) is a nitrogen-containing organic compo...

Compound Q&A

Is 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) safe?

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) requires careful handling due to its p...

Compound Q&A

How should 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) be stored?

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) should be stored in a cool, dry, and d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...