Compound Q&A

Is 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) safe?

Answer

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate
2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) requires careful handling due to its potential irritancy to skin, eyes, and respiratory systems. Safety data suggests it may have moderate toxicity if ingested or inhaled. Protective measures include wearing gloves, goggles, and a lab coat, and ensuring proper ventilation. Always follow OSHA and EPA guidelines for chemical exposure limits.

About

CAS No 65141-46-0
English Name 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate
Molecular Formula C8H9N3O4
Molecular Weight 211.17 g/mol
SMILES C1=CC(=CN=C1)C(=O)NCCO[N+](=O)[O-]
InChIKey LBHIOVVIQHSOQN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0)?

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) is a nitrogen-containing organic compo...

Compound Q&A

What are the main uses of 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0)?

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) is primarily used in pharmaceutical re...

Compound Q&A

How should 2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) be stored?

2-[(3-Pyridinylcarbonyl)amino]ethyl nitrate (CAS: 65141-46-0) should be stored in a cool, dry, and d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...