Compound Q&A

How should Afatinib (CAS: 850140-72-6) be stored?

Answer

Afatinib (BIBW 2992)
Afatinib (CAS: 850140-72-6) should be stored in a cool, dry, and dark place, away from moisture and light. It is typically kept at a temperature between 15°C and 25°C. The container should be airtight and properly labeled to maintain stability and prevent contamination.

About

English Name Afatinib (BIBW 2992)
Molecular Formula C24H25ClFN5O3
Molecular Weight 485.95 g/mol
SMILES CN(C)CC=CC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1O[C@H]4CCOC4
InChIKey ULXXDDBFHOBEHA-CWDCEQMOSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Afatinib (CAS: 850140-72-6)?

Afatinib, with the CAS number 850140-72-6, is a small molecule inhibitor used primarily in cancer th...

Compound Q&A

What are the main uses of Afatinib (CAS: 850140-72-6)?

Afatinib (CAS: 850140-72-6) is mainly used in the treatment of non-small cell lung cancer (NSCLC) an...

Compound Q&A

Is Afatinib (CAS: 850140-72-6) safe?

Afatinib (CAS: 850140-72-6) is generally safe when used as prescribed, but it may cause side effects...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...