Compound Q&A

Is 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2) safe?

Answer

2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside
The safety of 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2) depends on its application and exposure conditions. As a chemical compound, it should be handled with care in laboratory settings, using appropriate personal protective equipment. Safety data is limited, so following standard chemical safety protocols and consulting safety data sheets is recommended for proper handling and storage.

About

CAS No 82373-94-2
English Name 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside
Molecular Formula C20H22O9
Molecular Weight 406.39 g/mol
SMILES OC[C@H]1O[C@@H](Oc2c(/C=C/c3ccc(cc3)O)cc(cc2O)O)[C@@H]([C@H]([C@@H]1O)O)O
InChIKey JAYVHSBYKLLDJC-DSNJPTTOSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2)?

2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2) is a c...

Compound Q&A

What are the main uses of 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2)?

This compound is primarily used in pharmaceutical research for its potential biological activity, pa...

Compound Q&A

How should 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2) be stored?

To ensure stability, 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CA...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...