Compound Q&A

What are the main uses of 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2)?

Answer

2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside
This compound is primarily used in pharmaceutical research for its potential biological activity, particularly in the development of drugs targeting metabolic disorders. It also finds application in biochemical studies related to glycosylation processes and may be used in the synthesis of other complex organic molecules. Its specific uses are often dependent on its structural modifications and functional groups.

About

CAS No 82373-94-2
English Name 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside
Molecular Formula C20H22O9
Molecular Weight 406.39 g/mol
SMILES OC[C@H]1O[C@@H](Oc2c(/C=C/c3ccc(cc3)O)cc(cc2O)O)[C@@H]([C@H]([C@@H]1O)O)O
InChIKey JAYVHSBYKLLDJC-DSNJPTTOSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2)?

2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2) is a c...

Compound Q&A

Is 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2) safe?

The safety of 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 8237...

Compound Q&A

How should 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2) be stored?

To ensure stability, 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CA...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...