Compound Q&A

What is 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2)?

Answer

2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside
2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2) is a complex organic compound containing a glucopyranoside moiety and multiple hydroxyl groups. It is known for its structural features that make it relevant in pharmaceutical and biochemical research. The compound exhibits solubility in polar solvents and is typically used in specialized applications due to its unique chemical composition.

About

CAS No 82373-94-2
English Name 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside
Molecular Formula C20H22O9
Molecular Weight 406.39 g/mol
SMILES OC[C@H]1O[C@@H](Oc2c(/C=C/c3ccc(cc3)O)cc(cc2O)O)[C@@H]([C@H]([C@@H]1O)O)O
InChIKey JAYVHSBYKLLDJC-DSNJPTTOSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2)?

This compound is primarily used in pharmaceutical research for its potential biological activity, pa...

Compound Q&A

Is 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2) safe?

The safety of 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 8237...

Compound Q&A

How should 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 82373-94-2) be stored?

To ensure stability, 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CA...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...