Compound Q&A

How should 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) be stored?

Answer

2,3-Bis(benzoyloxy)succinic acid
2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) should be stored in a cool, dry, and well-ventilated area, away from direct light. It is recommended to keep it in a sealed container to prevent moisture absorption and maintain chemical stability. Storage should also follow guidelines to ensure compatibility with other materials and to avoid exposure to air or heat sources.

About

CAS No 17026-42-5
English Name 2,3-Bis(benzoyloxy)succinic acid
Molecular Formula C18H14O8
Molecular Weight 358.3 g/mol
SMILES c1ccc(cc1)C(=O)OC(C(C(=O)O)OC(=O)c2ccccc2)C(=O)O
InChIKey YONLFQNRGZXBBF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5)?

2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) is an organic compound with the chemical formula ...

Compound Q&A

What are the main uses of 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5)?

2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) is primarily used in pharmaceuticals as a buildin...

Compound Q&A

Is 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) safe?

2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) is generally considered safe when handled properl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...