Compound Q&A

What are the main uses of 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5)?

Answer

2,3-Bis(benzoyloxy)succinic acid
2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) is primarily used in pharmaceuticals as a building block for drug synthesis. It also finds applications in industrial processes, particularly in the production of polymers and coatings. In research, it serves as a useful reagent for organic reactions and can be utilized in the development of new materials and chemical compounds.

About

CAS No 17026-42-5
English Name 2,3-Bis(benzoyloxy)succinic acid
Molecular Formula C18H14O8
Molecular Weight 358.3 g/mol
SMILES c1ccc(cc1)C(=O)OC(C(C(=O)O)OC(=O)c2ccccc2)C(=O)O
InChIKey YONLFQNRGZXBBF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5)?

2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) is an organic compound with the chemical formula ...

Compound Q&A

Is 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) safe?

2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) is generally considered safe when handled properl...

Compound Q&A

How should 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) be stored?

2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) should be stored in a cool, dry, and well-ventila...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...