Compound Q&A

What is 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5)?

Answer

2,3-Bis(benzoyloxy)succinic acid
2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) is an organic compound with the chemical formula C16H14O7. It is a diacid derivative characterized by two benzoyloxy groups attached to the succinic acid backbone. This compound is known for its stability and is commonly used in various chemical applications due to its versatile functional groups.

About

CAS No 17026-42-5
English Name 2,3-Bis(benzoyloxy)succinic acid
Molecular Formula C18H14O8
Molecular Weight 358.3 g/mol
SMILES c1ccc(cc1)C(=O)OC(C(C(=O)O)OC(=O)c2ccccc2)C(=O)O
InChIKey YONLFQNRGZXBBF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5)?

2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) is primarily used in pharmaceuticals as a buildin...

Compound Q&A

Is 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) safe?

2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) is generally considered safe when handled properl...

Compound Q&A

How should 2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) be stored?

2,3-Bis(benzoyloxy)succinic acid (CAS: 17026-42-5) should be stored in a cool, dry, and well-ventila...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...