Compound Q&A

Is (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8) safe?

Answer

(3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid
Safety data for this compound is primarily based on its use in controlled laboratory and industrial environments. It is generally considered safe when handled properly, but standard precautions should be taken, such as wearing personal protective equipment (PPE) and ensuring proper ventilation. It is advisable to follow safety guidelines specific to its application in research or pharmaceutical settings.

About

English Name (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid
Molecular Formula C15H18F3NO4
Molecular Weight 333.31 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC(=C(C=C1F)F)F)CC(=O)O
InChIKey TUAXCHGULMWHIO-SECBINFHSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8)?

This compound is a butanoic acid derivative with a complex structure featuring a (3R) stereoconfigur...

Compound Q&A

What are the main uses of (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8)?

This compound is primarily used in pharmaceutical research for the development of drugs targeting sp...

Compound Q&A

How should (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8) be stored?

This compound should be stored in a cool, dry, and dark place, away from moisture and light. It is r...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...