Compound Q&A

What are the main uses of (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8)?

Answer

(3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid
This compound is primarily used in pharmaceutical research for the development of drugs targeting specific biological pathways. It also serves as an intermediate in the synthesis of other organic compounds, particularly those with fluorinated aromatic rings. Its unique structure makes it valuable in medicinal chemistry and as a building block for bioactive molecules.

About

English Name (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid
Molecular Formula C15H18F3NO4
Molecular Weight 333.31 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC(=C(C=C1F)F)F)CC(=O)O
InChIKey TUAXCHGULMWHIO-SECBINFHSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8)?

This compound is a butanoic acid derivative with a complex structure featuring a (3R) stereoconfigur...

Compound Q&A

Is (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8) safe?

Safety data for this compound is primarily based on its use in controlled laboratory and industrial ...

Compound Q&A

How should (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8) be stored?

This compound should be stored in a cool, dry, and dark place, away from moisture and light. It is r...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...