Compound Q&A

What is (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8)?

Answer

(3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid
This compound is a butanoic acid derivative with a complex structure featuring a (3R) stereoconfiguration, a (2-methyl-2-propanyl)oxy group, and a 2,4,5-trifluorophenyl substituent. It has the molecular formula C14H17F3NO4 and is known for its specific chemical properties and applications in organic synthesis. Its structure includes ester and amino functionalities, contributing to its reactivity and utility in various chemical contexts.

About

English Name (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid
Molecular Formula C15H18F3NO4
Molecular Weight 333.31 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC(=C(C=C1F)F)F)CC(=O)O
InChIKey TUAXCHGULMWHIO-SECBINFHSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8)?

This compound is primarily used in pharmaceutical research for the development of drugs targeting sp...

Compound Q&A

Is (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8) safe?

Safety data for this compound is primarily based on its use in controlled laboratory and industrial ...

Compound Q&A

How should (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid (CAS: 486460-00-8) be stored?

This compound should be stored in a cool, dry, and dark place, away from moisture and light. It is r...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...