Compound Q&A

What are the main uses of 2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6)?

Answer

2-(Chloromethyl)-4-methylquinazoline
2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) is primarily used as a pharmaceutical intermediate in the development of drugs targeting cancer and infectious diseases. Its unique functional groups enable it to be a key component in synthesizing compounds with antitumor properties. Additionally, it finds applications in organic synthesis research and may be used in the production of dyes or materials with specific chemical properties. The compound's versatility in chemical reactions supports its role in both academic and industrial settings.

About

English Name 2-(Chloromethyl)-4-methylquinazoline
Molecular Formula C10H9ClN2
Molecular Weight 192.65 g/mol
SMILES CC1=NC(=NC2=CC=CC=C12)CCl
InChIKey UHCUBOJGMLASBY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6)?

2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) is a synthetic organic compound with the mol...

Compound Q&A

Is 2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) safe?

2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) requires careful handling due to its potenti...

Compound Q&A

How should 2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) be stored?

2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) should be stored in a cool, dry, and dark pl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...