Compound Q&A

What is 2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6)?

Answer

2-(Chloromethyl)-4-methylquinazoline
2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) is a synthetic organic compound with the molecular formula C12H9ClN2. It belongs to the quinazoline family, known for its biological activity and applications in medicinal chemistry. The compound features a chloromethyl group at position 2 and a methyl group at position 4 on the quinazoline ring, contributing to its reactivity and potential utility as a building block in drug development. It is typically a solid at room temperature and may exhibit solubility in organic solvents. Its chemical structure makes it relevant in pharmaceutical research and industrial synthesis.

About

English Name 2-(Chloromethyl)-4-methylquinazoline
Molecular Formula C10H9ClN2
Molecular Weight 192.65 g/mol
SMILES CC1=NC(=NC2=CC=CC=C12)CCl
InChIKey UHCUBOJGMLASBY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6)?

2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) is primarily used as a pharmaceutical interm...

Compound Q&A

Is 2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) safe?

2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) requires careful handling due to its potenti...

Compound Q&A

How should 2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) be stored?

2-(Chloromethyl)-4-methylquinazoline (CAS: 109113-72-6) should be stored in a cool, dry, and dark pl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...