Compound Q&A

How should 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) be stored?

Answer

2,6-Dichloro-5-fluoronicotinic acid
2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) should be stored in a cool, dry, and well-ventilated area, away from light and moisture. It is best kept in a sealed container made of glass or high-density polyethylene (HDPE) to maintain stability and prevent contamination. Storage conditions should avoid exposure to heat and incompatible substances to ensure long-term integrity.

About

CAS No 82671-06-5
English Name 2,6-Dichloro-5-fluoronicotinic acid
Molecular Formula C6H2Cl2FNO2
Molecular Weight 209.99 g/mol
SMILES C1=C(C(=NC(=C1F)Cl)Cl)C(=O)O
InChIKey LTDGKGCHRNNCAC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5)?

2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) is a synthetic organic compound containing a n...

Compound Q&A

What are the main uses of 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5)?

2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) is primarily used in pharmaceutical research a...

Compound Q&A

Is 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) safe?

2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) is considered hazardous due to its potential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...