Compound Q&A

What are the main uses of 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5)?

Answer

2,6-Dichloro-5-fluoronicotinic acid
2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) is primarily used in pharmaceutical research as a building block for the development of drugs targeting metabolic disorders. It also finds applications in agrochemicals and as an intermediate in the synthesis of various organic compounds. Its unique chemical structure makes it valuable in studies related to enzyme inhibition and drug design.

About

CAS No 82671-06-5
English Name 2,6-Dichloro-5-fluoronicotinic acid
Molecular Formula C6H2Cl2FNO2
Molecular Weight 209.99099999999999 g/mol
SMILES C1=C(C(=NC(=C1F)Cl)Cl)C(=O)O
InChIKey LTDGKGCHRNNCAC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5)?

2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) is a synthetic organic compound containing a n...

Compound Q&A

Is 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) safe?

2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) is considered hazardous due to its potential t...

Compound Q&A

How should 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) be stored?

2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) should be stored in a cool, dry, and well-vent...

Compound Q&A

What are the main uses of 1H-Indazole-6-carbonitrile (CAS: 141290-59-7)?

1H-Indazole-6-carbonitrile finds applications in pharmaceuticals, where it serve...

141290-59-71H-Indazole-6-carbon...
Compound Q&A

How should waste containing Dioctyl (2E)-2-butenedioate (CAS: 2997-85-5) be handled?

Waste containing Dioctyl (2E)-2-butenedioate (CAS: 2997-85-5) should be collecte...

2997-85-5Dioctyl (2E)-2-buten...
Compound Q&A

What industries use Sodium [(1,2-benzoxazol-3-ylmethyl)sulfonyl]azanide (CAS: 68291-98-5)?

Sodium [(1,2-benzoxazol-3-ylmethyl)sulfonyl]azanide is primarily used in pharmac...

68291-98-5Sodium [(1,2-benzoxa...
Compound Q&A

Are there alternatives to Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-pyridinedicarboxylate (CAS: 741709-66-0) in synthesis?

Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-pyridinedicarboxyla...

741709-66-0Dimethyl 4-(4,4,5,5-...