Compound Q&A

What is 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5)?

Answer

2,6-Dichloro-5-fluoronicotinic acid
2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) is a synthetic organic compound containing a nicotinic acid core with two chlorine atoms and one fluorine atom substituents. It is a white crystalline solid with a molecular formula of C6H3Cl2FNO2 and exhibits moderate solubility in polar solvents. This compound is known for its potential applications in medicinal chemistry due to its structural versatility and biological activity.

About

CAS No 82671-06-5
English Name 2,6-Dichloro-5-fluoronicotinic acid
Molecular Formula C6H2Cl2FNO2
Molecular Weight 209.99099999999999 g/mol
SMILES C1=C(C(=NC(=C1F)Cl)Cl)C(=O)O
InChIKey LTDGKGCHRNNCAC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5)?

2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) is primarily used in pharmaceutical research a...

Compound Q&A

Is 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) safe?

2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) is considered hazardous due to its potential t...

Compound Q&A

How should 2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) be stored?

2,6-Dichloro-5-fluoronicotinic acid (CAS: 82671-06-5) should be stored in a cool, dry, and well-vent...

Compound Q&A

What are the main uses of 1H-Indazole-6-carbonitrile (CAS: 141290-59-7)?

1H-Indazole-6-carbonitrile finds applications in pharmaceuticals, where it serve...

141290-59-71H-Indazole-6-carbon...
Compound Q&A

How should waste containing Dioctyl (2E)-2-butenedioate (CAS: 2997-85-5) be handled?

Waste containing Dioctyl (2E)-2-butenedioate (CAS: 2997-85-5) should be collecte...

2997-85-5Dioctyl (2E)-2-buten...
Compound Q&A

What industries use Sodium [(1,2-benzoxazol-3-ylmethyl)sulfonyl]azanide (CAS: 68291-98-5)?

Sodium [(1,2-benzoxazol-3-ylmethyl)sulfonyl]azanide is primarily used in pharmac...

68291-98-5Sodium [(1,2-benzoxa...
Compound Q&A

Are there alternatives to Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-pyridinedicarboxylate (CAS: 741709-66-0) in synthesis?

Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-pyridinedicarboxyla...

741709-66-0Dimethyl 4-(4,4,5,5-...