Compound Q&A

How should Vinblastine sulfate (CAS: 143-67-9) be stored?

Answer

Vinblastine sulfate
Vinblastine sulfate should be stored in a cool, dry place away from light. It is typically kept in airtight containers at a temperature range of 20-25°C. Maintaining proper humidity levels and avoiding exposure to moisture is crucial for preserving its stability and potency over time.

About

CAS No 143-67-9
English Name Vinblastine sulfate
Molecular Formula C46H58N4O9.H2O4S
Molecular Weight 909.07 g/mol
SMILES CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O.OS(=O)(=O)O
InChIKey KDQAABAKXDWYSZ-PNYVAJAMSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Vinblastine sulfate (CAS: 143-67-9)?

Vinblastine sulfate is a chemotherapy drug used to treat various cancers. It has the chemical formul...

Compound Q&A

What are the main uses of Vinblastine sulfate (CAS: 143-67-9)?

Vinblastine sulfate is primarily used in cancer treatment, particularly for Hodgkin’s lymphoma, test...

Compound Q&A

Is Vinblastine sulfate (CAS: 143-67-9) safe?

Vinblastine sulfate is generally safe when used under medical supervision, but it can have side effe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...