Compound Q&A

Is Vinblastine sulfate (CAS: 143-67-9) safe?

Answer

Vinblastine sulfate
Vinblastine sulfate is generally safe when used under medical supervision, but it can have side effects such as bone marrow suppression and neuropathy. Proper handling, including the use of personal protective equipment, is essential to minimize risks. Safety standards ensure its controlled use in healthcare settings to protect both patients and handlers.

About

CAS No 143-67-9
English Name Vinblastine sulfate
Molecular Formula C46H58N4O9.H2O4S
Molecular Weight 909.07 g/mol
SMILES CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O.OS(=O)(=O)O
InChIKey KDQAABAKXDWYSZ-PNYVAJAMSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Vinblastine sulfate (CAS: 143-67-9)?

Vinblastine sulfate is a chemotherapy drug used to treat various cancers. It has the chemical formul...

Compound Q&A

What are the main uses of Vinblastine sulfate (CAS: 143-67-9)?

Vinblastine sulfate is primarily used in cancer treatment, particularly for Hodgkin’s lymphoma, test...

Compound Q&A

How should Vinblastine sulfate (CAS: 143-67-9) be stored?

Vinblastine sulfate should be stored in a cool, dry place away from light. It is typically kept in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...