Compound Q&A

How should 5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) be stored?

Answer

5H-Dibenzo[b,f]azepine-5-carboxamide
5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) should be stored in a cool, dry, and dark place away from moisture and strong light. It is typically kept in a sealed container at a temperature below 25°C. Ensure proper ventilation and avoid exposure to incompatible materials to maintain stability and prevent degradation.

About

CAS No 298-46-4
English Name 5H-Dibenzo[b,f]azepine-5-carboxamide
Molecular Formula C15H12N2O
Molecular Weight 236.27 g/mol
SMILES NC(=O)N1c2ccccc2C=Cc3ccccc13
InChIKey FFGPTBGBLSHEPO-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4)?

5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) is a heterocyclic organic compound containing a...

Compound Q&A

What are the main uses of 5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4)?

5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) is primarily used in pharmaceutical research fo...

Compound Q&A

Is 5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) safe?

5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) is generally considered safe when handled prope...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...