Compound Q&A

What are the main uses of 5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4)?

Answer

5H-Dibenzo[b,f]azepine-5-carboxamide
5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) is primarily used in pharmaceutical research for the development of drugs targeting neurological disorders. It also serves as an intermediate in the synthesis of various organic compounds and is studied for its potential applications in medicinal chemistry and material science. Its unique structure makes it valuable in drug design and chemical synthesis processes.

About

CAS No 298-46-4
English Name 5H-Dibenzo[b,f]azepine-5-carboxamide
Molecular Formula C15H12N2O
Molecular Weight 236.27 g/mol
SMILES NC(=O)N1c2ccccc2C=Cc3ccccc13
InChIKey FFGPTBGBLSHEPO-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4)?

5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) is a heterocyclic organic compound containing a...

Compound Q&A

Is 5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) safe?

5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) is generally considered safe when handled prope...

Compound Q&A

How should 5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) be stored?

5H-Dibenzo[b,f]azepine-5-carboxamide (CAS: 298-46-4) should be stored in a cool, dry, and dark place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...