Compound Q&A

How should Everolimus (CAS: 159351-69-6) be stored?

Answer

Everolimus
Everolimus should be stored in a cool, dry place away from light. It is typically kept in a sealed container at a temperature between 15°C to 25°C. Proper storage conditions help maintain its chemical stability and effectiveness over time.

About

English Name Everolimus
Molecular Formula C53H83NO14
Molecular Weight 958.22 g/mol
SMILES OCCO[C@@H]1CC[C@H](C[C@H]1OC)C[C@H]([C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@]2(O)O[C@@H](CC[C@H]2C)C[C@H](OC)C(=CC=CC=C[C@H](C[C@H](C(=O)[C@@H]([C@@H](C(=C[C@H](C(=O)C1)C)C)O)OC)C)C)C)C
InChIKey HKVAMNSJSFKALM-DHGBBOBXSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Everolimus (CAS: 159351-69-6)?

Everolimus is a chemical compound with the CAS number 159351-69-6. It is an mTOR inhibitor, a type o...

Compound Q&A

What are the main uses of Everolimus (CAS: 159351-69-6)?

Everolimus is primarily used in pharmaceutical applications as an immunosuppressant to reduce the ri...

Compound Q&A

Is Everolimus (CAS: 159351-69-6) safe?

Everolimus is generally considered safe when used as directed, but it can have side effects such as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...