Compound Q&A

Is Everolimus (CAS: 159351-69-6) safe?

Answer

Everolimus
Everolimus is generally considered safe when used as directed, but it can have side effects such as diarrhea, mouth sores, and increased infection risk. Proper handling and adherence to safety guidelines are essential. It is regulated by safety standards to ensure safe use in medical and research settings.

About

English Name Everolimus
Molecular Formula C53H83NO14
Molecular Weight 958.22 g/mol
SMILES OCCO[C@@H]1CC[C@H](C[C@H]1OC)C[C@H]([C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@]2(O)O[C@@H](CC[C@H]2C)C[C@H](OC)C(=CC=CC=C[C@H](C[C@H](C(=O)[C@@H]([C@@H](C(=C[C@H](C(=O)C1)C)C)O)OC)C)C)C)C
InChIKey HKVAMNSJSFKALM-DHGBBOBXSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Everolimus (CAS: 159351-69-6)?

Everolimus is a chemical compound with the CAS number 159351-69-6. It is an mTOR inhibitor, a type o...

Compound Q&A

What are the main uses of Everolimus (CAS: 159351-69-6)?

Everolimus is primarily used in pharmaceutical applications as an immunosuppressant to reduce the ri...

Compound Q&A

How should Everolimus (CAS: 159351-69-6) be stored?

Everolimus should be stored in a cool, dry place away from light. It is typically kept in a sealed c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...