Compound Q&A

How should 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) be stored?

Answer

1,4-Naphthalenedicarboxylic acid
1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) should be stored in a cool, dry place, preferably at 20-25°C, and protected from light. Keep it in a sealed, airtight container to prevent moisture and air exposure, which can affect its stability. Avoid storing near incompatible substances and ensure proper labeling for safe handling and storage.

About

CAS No 605-70-9
English Name 1,4-Naphthalenedicarboxylic acid
Molecular Formula C12H8O4
Molecular Weight 216.19 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2C(=O)O)C(=O)O
InChIKey ABMFBCRYHDZLRD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9)?

1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) is a white crystalline organic compound with the ch...

Compound Q&A

What are the main uses of 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9)?

1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) is widely utilized in the production of polyesters,...

Compound Q&A

Is 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) safe?

1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) is generally considered safe when handled properly....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...