Compound Q&A

What is 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9)?

Answer

1,4-Naphthalenedicarboxylic acid
1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) is a white crystalline organic compound with the chemical formula C14H10O4. It belongs to the class of naphthalenedicarboxylic acids and features two carboxylic acid groups attached to the 1,4 positions of a naphthalene ring. This compound is known for its high thermal stability and is commonly used as a precursor in polymer synthesis and chemical research.

About

CAS No 605-70-9
English Name 1,4-Naphthalenedicarboxylic acid
Molecular Formula C12H8O4
Molecular Weight 216.19 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2C(=O)O)C(=O)O
InChIKey ABMFBCRYHDZLRD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9)?

1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) is widely utilized in the production of polyesters,...

Compound Q&A

Is 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) safe?

1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) is generally considered safe when handled properly....

Compound Q&A

How should 1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) be stored?

1,4-Naphthalenedicarboxylic acid (CAS: 605-70-9) should be stored in a cool, dry place, preferably a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...